C29H28FNO5 — CID 67182291
2-[2-[(2S,3S,4R,5S)-2-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethyl]-4,5-dihydroxyoxolan-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 67182291) has the molecular formula C29H28FNO5 and a molecular weight of 489.54 g/mol. Its IUPAC name is 2-[2-[(2S,3S,4R,5S)-2-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethyl]-4,5-dihydroxyoxolan-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S,3S,4R,5S)-2-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethyl]-4,5-dihydroxyoxolan-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67182291 |
| Molecular Formula | C29H28FNO5 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[2-[(2S,3S,4R,5S)-2-[2-[4-(3-fluoro-4-methylphenyl)phenyl]ethyl]-4,5-dihydroxyoxolan-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(CC[C@@H]3O[C@H](O)[C@H](O)[C@@H]3CCN3C(=O)c4ccccc4C3=O)cc2)cc1F |
| InChI | InChI=1S/C29H28FNO5/c1-17-6-10-20(16-24(17)30)19-11-7-18(8-12-19)9-13-25-23(26(32)29(35)36-25)14-15-31-27(33)21-4-2-3-5-22(21)28(31)34/h2-8,10-12,16,23,25-26,29,32,35H,9,13-15H2,1H3/t23-,25+,26-,29+/m1/s1 |
| InChIKey | USZZUGHPNZKRQG-HYFMXHDLSA-N |
| XLogP | 4.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|