About spiro[3H-isoquinoline-4,4'-piperidine]
spiro[3H-isoquinoline-4,4'-piperidine] (PubChem CID 67182636) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is spiro[3H-isoquinoline-4,4'-piperidine].
Molecular Properties
| Compound Name | spiro[3H-isoquinoline-4,4'-piperidine] |
| PubChem CID | 67182636 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | spiro[3H-isoquinoline-4,4'-piperidine] |
| SMILES | C1=NCC2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C13H16N2/c1-2-4-12-11(3-1)9-15-10-13(12)5-7-14-8-6-13/h1-4,9,14H,5-8,10H2 |
| InChIKey | AKQLGKYCCRIIMZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3H-isoquinoline-4,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-isoquinoline-4,4'-piperidine]?
The IUPAC name of spiro[3H-isoquinoline-4,4'-piperidine] (CID 67182636) is spiro[3H-isoquinoline-4,4'-piperidine].
What is the SMILES notation for spiro[3H-isoquinoline-4,4'-piperidine]?
The canonical SMILES for spiro[3H-isoquinoline-4,4'-piperidine] is C1=NCC2(CCNCC2)c2ccccc21.
What is the InChIKey of spiro[3H-isoquinoline-4,4'-piperidine]?
The InChIKey is AKQLGKYCCRIIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-2-4-12-11(3-1)9-15-10-13(12)5-7-14-8-6-13/h1-4,9,14H,5-8,10H2.
What are the key properties of spiro[3H-isoquinoline-4,4'-piperidine]?
spiro[3H-isoquinoline-4,4'-piperidine] has a molecular weight of 200.29 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-isoquinoline-4,4'-piperidine] is sourced from PubChem (CID 67182636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).