About 5-amino-1,3-dimethylbenzimidazol-2-one;azane
5-amino-1,3-dimethylbenzimidazol-2-one;azane (PubChem CID 67182672) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is 5-amino-1,3-dimethylbenzimidazol-2-one;azane.
Molecular Properties
| Compound Name | 5-amino-1,3-dimethylbenzimidazol-2-one;azane |
| PubChem CID | 67182672 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 5-amino-1,3-dimethylbenzimidazol-2-one;azane |
| SMILES | Cn1c(=O)n(C)c2cc(N)ccc21.N |
| InChI | InChI=1S/C9H11N3O.H3N/c1-11-7-4-3-6(10)5-8(7)12(2)9(11)13;/h3-5H,10H2,1-2H3;1H3 |
| InChIKey | MWSGLYCQSVCTMP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,3-dimethylbenzimidazol-2-one;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-dimethylbenzimidazol-2-one;azane?
The IUPAC name of 5-amino-1,3-dimethylbenzimidazol-2-one;azane (CID 67182672) is 5-amino-1,3-dimethylbenzimidazol-2-one;azane.
What is the SMILES notation for 5-amino-1,3-dimethylbenzimidazol-2-one;azane?
The canonical SMILES for 5-amino-1,3-dimethylbenzimidazol-2-one;azane is Cn1c(=O)n(C)c2cc(N)ccc21.N.
What is the InChIKey of 5-amino-1,3-dimethylbenzimidazol-2-one;azane?
The InChIKey is MWSGLYCQSVCTMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O.H3N/c1-11-7-4-3-6(10)5-8(7)12(2)9(11)13;/h3-5H,10H2,1-2H3;1H3.
What are the key properties of 5-amino-1,3-dimethylbenzimidazol-2-one;azane?
5-amino-1,3-dimethylbenzimidazol-2-one;azane has a molecular weight of 194.24 g/mol, XLogP of 0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-dimethylbenzimidazol-2-one;azane is sourced from PubChem (CID 67182672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).