C21H32N4O3 — CID 67182925
4-(2-aminoethyl)benzene-1,2-diol;5-[(2R,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine (PubChem CID 67182925) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;5-[(2R,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;5-[(2R,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 67182925 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;5-[(2R,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine |
| SMILES | CCCN1C[C@@H](c2ccc(N)nc2)OC[C@@H]1C.NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H21N3O.C8H11NO2/c1-3-6-16-8-12(17-9-10(16)2)11-4-5-13(14)15-7-11;9-4-3-6-1-2-7(10)8(11)5-6/h4-5,7,10,12H,3,6,8-9H2,1-2H3,(H2,14,15);1-2,5,10-11H,3-4,9H2/t10-,12-;/m0./s1 |
| InChIKey | PPKLEOSMWOYLQJ-JGAZGGJJSA-N |
| XLogP | 2.43 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|