C18H28BN3O4 — CID 67183238
ethyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-4-carboxylate (PubChem CID 67183238) has the molecular formula C18H28BN3O4 and a molecular weight of 361.25 g/mol. Its IUPAC name is ethyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 67183238 |
| Molecular Formula | C18H28BN3O4 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | ethyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C18H28BN3O4/c1-6-24-15(23)13-7-9-22(10-8-13)16-20-11-14(12-21-16)19-25-17(2,3)18(4,5)26-19/h11-13H,6-10H2,1-5H3 |
| InChIKey | IMMSJEQXDMNKNL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|