C20H21F3N4O2 — CID 67183356
methyl 5-[[(4aR,9bS)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-yl]amino]pyridine-3-carboxylate (PubChem CID 67183356) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is methyl 5-[[(4aR,9bS)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-yl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 5-[[(4aR,9bS)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-yl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67183356 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | methyl 5-[[(4aR,9bS)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-yl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(Nc2cc3c(c(C(F)(F)F)c2)N(C)[C@@H]2CCNC[C@H]32)c1 |
| InChI | InChI=1S/C20H21F3N4O2/c1-27-17-3-4-24-10-15(17)14-6-12(7-16(18(14)27)20(21,22)23)26-13-5-11(8-25-9-13)19(28)29-2/h5-9,15,17,24,26H,3-4,10H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | CXIDLOKTYGIOJX-NVXWUHKLSA-N |
| XLogP | 3.53 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |