C25H26N4O3 — CID 67183429
N-[3-(benzylamino)-4-nitrophenyl]-N-phenylpiperidine-2-carboxamide (PubChem CID 67183429) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[3-(benzylamino)-4-nitrophenyl]-N-phenylpiperidine-2-carboxamide.
| Compound Name | N-[3-(benzylamino)-4-nitrophenyl]-N-phenylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 67183429 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[3-(benzylamino)-4-nitrophenyl]-N-phenylpiperidine-2-carboxamide |
| SMILES | O=C(C1CCCCN1)N(c1ccccc1)c1ccc([N+](=O)[O-])c(NCc2ccccc2)c1 |
| InChI | InChI=1S/C25H26N4O3/c30-25(22-13-7-8-16-26-22)28(20-11-5-2-6-12-20)21-14-15-24(29(31)32)23(17-21)27-18-19-9-3-1-4-10-19/h1-6,9-12,14-15,17,22,26-27H,7-8,13,16,18H2 |
| InChIKey | XCHUDAUTEMTXCM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|