About 1H-imidazol-3-ium;2,2,2-trifluoroacetate
1H-imidazol-3-ium;2,2,2-trifluoroacetate (PubChem CID 67183781) has the molecular formula C5H5F3N2O2
and a molecular weight of 182.10 g/mol. Its IUPAC name is 1H-imidazol-3-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1H-imidazol-3-ium;2,2,2-trifluoroacetate |
| PubChem CID | 67183781 |
| Molecular Formula | C5H5F3N2O2 |
| Molecular Weight | 182.10 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 1H-imidazol-3-ium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C3H4N2.C2HF3O2/c1-2-5-3-4-1;3-2(4,5)1(6)7/h1-3H,(H,4,5);(H,6,7) |
| InChIKey | KAIPJQCQNJYTCR-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.10 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-imidazol-3-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-3-ium;2,2,2-trifluoroacetate?
The IUPAC name of 1H-imidazol-3-ium;2,2,2-trifluoroacetate (CID 67183781) is 1H-imidazol-3-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for 1H-imidazol-3-ium;2,2,2-trifluoroacetate?
The canonical SMILES for 1H-imidazol-3-ium;2,2,2-trifluoroacetate is O=C([O-])C(F)(F)F.c1c[nH+]c[nH]1.
What is the InChIKey of 1H-imidazol-3-ium;2,2,2-trifluoroacetate?
The InChIKey is KAIPJQCQNJYTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2HF3O2/c1-2-5-3-4-1;3-2(4,5)1(6)7/h1-3H,(H,4,5);(H,6,7).
What are the key properties of 1H-imidazol-3-ium;2,2,2-trifluoroacetate?
1H-imidazol-3-ium;2,2,2-trifluoroacetate has a molecular weight of 182.10 g/mol, XLogP of -0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-3-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 67183781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).