C25H28FN5O2S — CID 67183799
(1R,10S,13R)-N-(cyclobutylsulfamoyl)-5-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine (PubChem CID 67183799) has the molecular formula C25H28FN5O2S and a molecular weight of 481.60 g/mol. Its IUPAC name is (1R,10S,13R)-N-(cyclobutylsulfamoyl)-5-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine.
| Compound Name | (1R,10S,13R)-N-(cyclobutylsulfamoyl)-5-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine |
|---|---|
| PubChem CID | 67183799 |
| Molecular Formula | C25H28FN5O2S |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (1R,10S,13R)-N-(cyclobutylsulfamoyl)-5-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]tricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine |
| SMILES | O=S(=O)(NC1CCC1)N[C@H]1[C@@H]2CC[C@H]1Cc1ccc(-c3ncn(-c4ccc(F)cc4)n3)cc1C2 |
| InChI | InChI=1S/C25H28FN5O2S/c26-21-8-10-23(11-9-21)31-15-27-25(28-31)19-7-4-16-12-17-5-6-18(13-20(16)14-19)24(17)30-34(32,33)29-22-2-1-3-22/h4,7-11,14-15,17-18,22,24,29-30H,1-3,5-6,12-13H2/t17-,18+,24+/m0/s1 |
| InChIKey | ZWISYSYXQCECOV-HOOSLVGPSA-N |
| XLogP | 3.54 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |