C28H45N3O2 — CID 67184131
1-(cyclohexylmethyl)-1-[2-[(1R,5S)-3-(3-hydroxyphenyl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-3-pentylurea (PubChem CID 67184131) has the molecular formula C28H45N3O2 and a molecular weight of 455.69 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-1-[2-[(1R,5S)-3-(3-hydroxyphenyl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-3-pentylurea.
| Compound Name | 1-(cyclohexylmethyl)-1-[2-[(1R,5S)-3-(3-hydroxyphenyl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-3-pentylurea |
|---|---|
| PubChem CID | 67184131 |
| Molecular Formula | C28H45N3O2 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 455.35 |
| IUPAC Name | 1-(cyclohexylmethyl)-1-[2-[(1R,5S)-3-(3-hydroxyphenyl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)N(CCN1[C@@H]2CC[C@H]1CC(c1cccc(O)c1)C2)CC1CCCCC1 |
| InChI | InChI=1S/C28H45N3O2/c1-2-3-7-15-29-28(33)30(21-22-9-5-4-6-10-22)16-17-31-25-13-14-26(31)19-24(18-25)23-11-8-12-27(32)20-23/h8,11-12,20,22,24-26,32H,2-7,9-10,13-19,21H2,1H3,(H,29,33)/t24?,25-,26+ |
| InChIKey | DYQFMFXPHQIZNH-NXMIGULDSA-N |
| XLogP | 5.88 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|