C22H42Si — CID 67184273
1,1,2,3-tetrabutyl-4,5-dimethylsilole (PubChem CID 67184273) has the molecular formula C22H42Si and a molecular weight of 334.66 g/mol. Its IUPAC name is 1,1,2,3-tetrabutyl-4,5-dimethylsilole.
| Compound Name | 1,1,2,3-tetrabutyl-4,5-dimethylsilole |
|---|---|
| PubChem CID | 67184273 |
| Molecular Formula | C22H42Si |
| Molecular Weight | 334.66 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | 1,1,2,3-tetrabutyl-4,5-dimethylsilole |
| SMILES | CCCCC1=C(CCCC)[Si](CCCC)(CCCC)C(C)=C1C |
| InChI | InChI=1S/C22H42Si/c1-7-11-15-21-19(5)20(6)23(17-13-9-3,18-14-10-4)22(21)16-12-8-2/h7-18H2,1-6H3 |
| InChIKey | XPCZTNLVOSVFOS-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.66 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|