C18H23ClN4O2 — CID 67184808
3-amino-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 67184808) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 3-amino-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67184808 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-amino-N-[6-(2-methoxyphenyl)pyrimidin-4-yl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | COc1ccccc1-c1cc(NC(=O)C2CCCC(N)C2)ncn1.Cl |
| InChI | InChI=1S/C18H22N4O2.ClH/c1-24-16-8-3-2-7-14(16)15-10-17(21-11-20-15)22-18(23)12-5-4-6-13(19)9-12;/h2-3,7-8,10-13H,4-6,9,19H2,1H3,(H,20,21,22,23);1H |
| InChIKey | LCKZIXNIRVIEFS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |