About ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate
ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate (PubChem CID 67185003) has the molecular formula C25H20F3NO3S
and a molecular weight of 471.50 g/mol. Its IUPAC name is ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate |
| PubChem CID | 67185003 |
| Molecular Formula | C25H20F3NO3S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2cccc3cc(Cc4ccc(OCC(F)(F)F)nc4)sc23)c1 |
| InChI | InChI=1S/C25H20F3NO3S/c1-2-31-24(30)19-7-3-5-17(12-19)21-8-4-6-18-13-20(33-23(18)21)11-16-9-10-22(29-14-16)32-15-25(26,27)28/h3-10,12-14H,2,11,15H2,1H3 |
| InChIKey | UZZUBVCDSYZSER-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate?
The IUPAC name of ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate (CID 67185003) is ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate.
What is the SMILES notation for ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate?
The canonical SMILES for ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate is CCOC(=O)c1cccc(-c2cccc3cc(Cc4ccc(OCC(F)(F)F)nc4)sc23)c1.
What is the InChIKey of ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate?
The InChIKey is UZZUBVCDSYZSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F3NO3S/c1-2-31-24(30)19-7-3-5-17(12-19)21-8-4-6-18-13-20(33-23(18)21)11-16-9-10-22(29-14-16)32-15-25(26,27)28/h3-10,12-14H,2,11,15H2,1H3.
What are the key properties of ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate?
ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate has a molecular weight of 471.50 g/mol, XLogP of 6.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-1-benzothiophen-7-yl]benzoate is sourced from PubChem (CID 67185003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).