About 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid
3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid (PubChem CID 67185184) has the molecular formula C22H14F3NO2S
and a molecular weight of 413.42 g/mol. Its IUPAC name is 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid |
| PubChem CID | 67185184 |
| Molecular Formula | C22H14F3NO2S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccnc3cc(Cc4cccc(C(F)(F)F)c4)sc23)c1 |
| InChI | InChI=1S/C22H14F3NO2S/c23-22(24,25)16-6-1-3-13(9-16)10-17-12-19-20(29-17)18(7-8-26-19)14-4-2-5-15(11-14)21(27)28/h1-9,11-12H,10H2,(H,27,28) |
| InChIKey | ZPCSGPDVLHMVBR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid?
The IUPAC name of 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid (CID 67185184) is 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid.
What is the SMILES notation for 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid?
The canonical SMILES for 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid is O=C(O)c1cccc(-c2ccnc3cc(Cc4cccc(C(F)(F)F)c4)sc23)c1.
What is the InChIKey of 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid?
The InChIKey is ZPCSGPDVLHMVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F3NO2S/c23-22(24,25)16-6-1-3-13(9-16)10-17-12-19-20(29-17)18(7-8-26-19)14-4-2-5-15(11-14)21(27)28/h1-9,11-12H,10H2,(H,27,28).
What are the key properties of 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid?
3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid has a molecular weight of 413.42 g/mol, XLogP of 6.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyridin-7-yl]benzoic acid is sourced from PubChem (CID 67185184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).