About 4-phenylpent-3-ene-1,2-diol
4-phenylpent-3-ene-1,2-diol (PubChem CID 67185961) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-phenylpent-3-ene-1,2-diol.
Molecular Properties
| Compound Name | 4-phenylpent-3-ene-1,2-diol |
| PubChem CID | 67185961 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-phenylpent-3-ene-1,2-diol |
| SMILES | CC(=CC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-9(7-11(13)8-12)10-5-3-2-4-6-10/h2-7,11-13H,8H2,1H3 |
| InChIKey | ONYBYOOLDZIFMN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylpent-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpent-3-ene-1,2-diol?
The IUPAC name of 4-phenylpent-3-ene-1,2-diol (CID 67185961) is 4-phenylpent-3-ene-1,2-diol.
What is the SMILES notation for 4-phenylpent-3-ene-1,2-diol?
The canonical SMILES for 4-phenylpent-3-ene-1,2-diol is CC(=CC(O)CO)c1ccccc1.
What is the InChIKey of 4-phenylpent-3-ene-1,2-diol?
The InChIKey is ONYBYOOLDZIFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-9(7-11(13)8-12)10-5-3-2-4-6-10/h2-7,11-13H,8H2,1H3.
What are the key properties of 4-phenylpent-3-ene-1,2-diol?
4-phenylpent-3-ene-1,2-diol has a molecular weight of 178.23 g/mol, XLogP of 1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpent-3-ene-1,2-diol is sourced from PubChem (CID 67185961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).