C7H5F2NO3 — CID 67186515
2-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 67186515) has the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 2-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67186515 |
| Molecular Formula | C7H5F2NO3 |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 2-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(=O)[nH]c1C(F)F |
| InChI | InChI=1S/C7H5F2NO3/c8-6(9)5-3(7(12)13)1-2-4(11)10-5/h1-2,6H,(H,10,11)(H,12,13) |
| InChIKey | AQHUWMGXGIWJEQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |