C23H31N5O2S — CID 67186594
6,6-dimethyl-2-[7-[methyl(2-pyrrolidin-1-ylethyl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 67186594) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is 6,6-dimethyl-2-[7-[methyl(2-pyrrolidin-1-ylethyl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 6,6-dimethyl-2-[7-[methyl(2-pyrrolidin-1-ylethyl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 67186594 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 6,6-dimethyl-2-[7-[methyl(2-pyrrolidin-1-ylethyl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | CN(CCN1CCCC1)c1ccc2c(c1)OCCN2c1nc2c(s1)C(=O)NC(C)(C)C2 |
| InChI | InChI=1S/C23H31N5O2S/c1-23(2)15-17-20(21(29)25-23)31-22(24-17)28-12-13-30-19-14-16(6-7-18(19)28)26(3)10-11-27-8-4-5-9-27/h6-7,14H,4-5,8-13,15H2,1-3H3,(H,25,29) |
| InChIKey | LQRMOMYYLRISMQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|