C20H23F3N2O2 — CID 67186601
tert-butyl N-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]carbamate (PubChem CID 67186601) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is tert-butyl N-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67186601 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | tert-butyl N-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CNCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-19(2,3)27-18(26)25-17-10-6-15(7-11-17)13-24-12-14-4-8-16(9-5-14)20(21,22)23/h4-11,24H,12-13H2,1-3H3,(H,25,26) |
| InChIKey | BMUVKCZVKDGBDM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |