C29H34F3N3O4 — CID 67186858
2-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid (PubChem CID 67186858) has the molecular formula C29H34F3N3O4 and a molecular weight of 545.60 g/mol. Its IUPAC name is 2-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67186858 |
| Molecular Formula | C29H34F3N3O4 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 2-[[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCCCc1noc(-c2ccc(CN(C(=O)C(=O)O)C(CC)c3ccc(C(F)(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C29H34F3N3O4/c1-3-5-6-7-8-9-10-25-33-26(39-34-25)22-13-11-20(12-14-22)19-35(27(36)28(37)38)24(4-2)21-15-17-23(18-16-21)29(30,31)32/h11-18,24H,3-10,19H2,1-2H3,(H,37,38) |
| InChIKey | GQWYXVYAKMMGBH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|