About 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol
4-cyclopentyl-3-(3,5-dimethylphenyl)phenol (PubChem CID 67187515) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol.
Molecular Properties
| Compound Name | 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol |
| PubChem CID | 67187515 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol |
| SMILES | Cc1cc(C)cc(-c2cc(O)ccc2C2CCCC2)c1 |
| InChI | InChI=1S/C19H22O/c1-13-9-14(2)11-16(10-13)19-12-17(20)7-8-18(19)15-5-3-4-6-15/h7-12,15,20H,3-6H2,1-2H3 |
| InChIKey | QJOSUSGZQXPWHB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol?
The IUPAC name of 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol (CID 67187515) is 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol.
What is the SMILES notation for 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol?
The canonical SMILES for 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol is Cc1cc(C)cc(-c2cc(O)ccc2C2CCCC2)c1.
What is the InChIKey of 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol?
The InChIKey is QJOSUSGZQXPWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O/c1-13-9-14(2)11-16(10-13)19-12-17(20)7-8-18(19)15-5-3-4-6-15/h7-12,15,20H,3-6H2,1-2H3.
What are the key properties of 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol?
4-cyclopentyl-3-(3,5-dimethylphenyl)phenol has a molecular weight of 266.38 g/mol, XLogP of 5.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-3-(3,5-dimethylphenyl)phenol is sourced from PubChem (CID 67187515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).