About 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole
4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole (PubChem CID 67187600) has the molecular formula C22H15Br2F3N4
and a molecular weight of 552.19 g/mol. Its IUPAC name is 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole.
Molecular Properties
| Compound Name | 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole |
| PubChem CID | 67187600 |
| Molecular Formula | C22H15Br2F3N4 |
| Molecular Weight | 552.19 g/mol |
| Exact Mass | 549.96 |
| IUPAC Name | 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole |
| SMILES | Brc1cccc2[nH]ncc12.FC(F)(F)c1cccc(Cn2cc3c(Br)cccc3n2)c1 |
| InChI | InChI=1S/C15H10BrF3N2.C7H5BrN2/c16-13-5-2-6-14-12(13)9-21(20-14)8-10-3-1-4-11(7-10)15(17,18)19;8-6-2-1-3-7-5(6)4-9-10-7/h1-7,9H,8H2;1-4H,(H,9,10) |
| InChIKey | BWUJZETVBPGDEL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.19 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole?
The IUPAC name of 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole (CID 67187600) is 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole.
What is the SMILES notation for 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole?
The canonical SMILES for 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole is Brc1cccc2[nH]ncc12.FC(F)(F)c1cccc(Cn2cc3c(Br)cccc3n2)c1.
What is the InChIKey of 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole?
The InChIKey is BWUJZETVBPGDEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrF3N2.C7H5BrN2/c16-13-5-2-6-14-12(13)9-21(20-14)8-10-3-1-4-11(7-10)15(17,18)19;8-6-2-1-3-7-5(6)4-9-10-7/h1-7,9H,8H2;1-4H,(H,9,10).
What are the key properties of 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole?
4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole has a molecular weight of 552.19 g/mol, XLogP of 7.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-indazole;4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole is sourced from PubChem (CID 67187600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).