About 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine
4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 67187732) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 67187732 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC1CCc2c1cccc2N1CCCCCC1 |
| InChI | InChI=1S/C15H22N2/c16-14-9-8-13-12(14)6-5-7-15(13)17-10-3-1-2-4-11-17/h5-7,14H,1-4,8-11,16H2 |
| InChIKey | PAQUPJQUDYHOMP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine (CID 67187732) is 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine is NC1CCc2c1cccc2N1CCCCCC1.
What is the InChIKey of 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine?
The InChIKey is PAQUPJQUDYHOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c16-14-9-8-13-12(14)6-5-7-15(13)17-10-3-1-2-4-11-17/h5-7,14H,1-4,8-11,16H2.
What are the key properties of 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine?
4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine has a molecular weight of 230.35 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azepan-1-yl)-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 67187732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).