C20H14N2O4 — CID 67187918
9-[(1,3-dioxoisoindol-2-yl)methyl]-2,5-dihydro-1,6-benzodioxocine-8-carbonitrile (PubChem CID 67187918) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 9-[(1,3-dioxoisoindol-2-yl)methyl]-2,5-dihydro-1,6-benzodioxocine-8-carbonitrile.
| Compound Name | 9-[(1,3-dioxoisoindol-2-yl)methyl]-2,5-dihydro-1,6-benzodioxocine-8-carbonitrile |
|---|---|
| PubChem CID | 67187918 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 9-[(1,3-dioxoisoindol-2-yl)methyl]-2,5-dihydro-1,6-benzodioxocine-8-carbonitrile |
| SMILES | N#Cc1cc2c(cc1CN1C(=O)c3ccccc3C1=O)OCC=CCO2 |
| InChI | InChI=1S/C20H14N2O4/c21-11-13-9-17-18(26-8-4-3-7-25-17)10-14(13)12-22-19(23)15-5-1-2-6-16(15)20(22)24/h1-6,9-10H,7-8,12H2 |
| InChIKey | AGVGPXBZFUAHOW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|