C25H30F3N3O — CID 67187973
1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine (PubChem CID 67187973) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine.
| Compound Name | 1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 67187973 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine |
| SMILES | CCCCCCCCc1noc(-c2ccc(CNCc3ccccc3C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C25H30F3N3O/c1-2-3-4-5-6-7-12-23-30-24(32-31-23)20-15-13-19(14-16-20)17-29-18-21-10-8-9-11-22(21)25(26,27)28/h8-11,13-16,29H,2-7,12,17-18H2,1H3 |
| InChIKey | RSPYXPSTTOVCAB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|