C29H36ClN3O4 — CID 67188443
2-[2-(3-chlorophenyl)ethyl-[1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]propyl]amino]-2-oxoacetic acid (PubChem CID 67188443) has the molecular formula C29H36ClN3O4 and a molecular weight of 526.08 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethyl-[1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]propyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[2-(3-chlorophenyl)ethyl-[1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]propyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67188443 |
| Molecular Formula | C29H36ClN3O4 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethyl-[1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]propyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCCCc1noc(-c2ccc(C(CC)N(CCc3cccc(Cl)c3)C(=O)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C29H36ClN3O4/c1-3-5-6-7-8-9-13-26-31-27(37-32-26)23-16-14-22(15-17-23)25(4-2)33(28(34)29(35)36)19-18-21-11-10-12-24(30)20-21/h10-12,14-17,20,25H,3-9,13,18-19H2,1-2H3,(H,35,36) |
| InChIKey | NXPNJDODXSJRPG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|