C14H17BrF3N3O3 — CID 67188567
5-(4-amino-3-bromophenyl)-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 67188567) has the molecular formula C14H17BrF3N3O3 and a molecular weight of 412.21 g/mol. Its IUPAC name is 5-(4-amino-3-bromophenyl)-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(4-amino-3-bromophenyl)-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67188567 |
| Molecular Formula | C14H17BrF3N3O3 |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 5-(4-amino-3-bromophenyl)-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC(c2ccc(N)c(Br)c2)CN(C)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16BrN3O.C2HF3O2/c1-15-6-9(7-16(2)12(15)17)8-3-4-11(14)10(13)5-8;3-2(4,5)1(6)7/h3-5,9H,6-7,14H2,1-2H3;(H,6,7) |
| InChIKey | WAOORISDAOXWNG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|