C19H27N5O4 — CID 67188676
formic acid;N-[5-(5-methoxy-3-pyridinyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide (PubChem CID 67188676) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is formic acid;N-[5-(5-methoxy-3-pyridinyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide.
| Compound Name | formic acid;N-[5-(5-methoxy-3-pyridinyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 67188676 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | formic acid;N-[5-(5-methoxy-3-pyridinyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide |
| SMILES | COc1cncc(-c2cc(NC(=O)CCCN3CCCCC3)n[nH]2)c1.O=CO |
| InChI | InChI=1S/C18H25N5O2.CH2O2/c1-25-15-10-14(12-19-13-15)16-11-17(22-21-16)20-18(24)6-5-9-23-7-3-2-4-8-23;2-1-3/h10-13H,2-9H2,1H3,(H2,20,21,22,24);1H,(H,2,3) |
| InChIKey | JFNHYJHHHJSKEP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|