About 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine
8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine (PubChem CID 67188811) has the molecular formula C14H10BrN5O2S
and a molecular weight of 392.24 g/mol. Its IUPAC name is 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine.
Molecular Properties
| Compound Name | 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine |
| PubChem CID | 67188811 |
| Molecular Formula | C14H10BrN5O2S |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(SC3=COC(c4ccccc4Br)O3)[nH]c12 |
| InChI | InChI=1S/C14H10BrN5O2S/c15-8-4-2-1-3-7(8)13-21-5-9(22-13)23-14-19-10-11(16)17-6-18-12(10)20-14/h1-6,13H,(H3,16,17,18,19,20) |
| InChIKey | OAYZCOJTVNTZCO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine?
The IUPAC name of 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine (CID 67188811) is 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine.
What is the SMILES notation for 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine?
The canonical SMILES for 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine is Nc1ncnc2nc(SC3=COC(c4ccccc4Br)O3)[nH]c12.
What is the InChIKey of 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine?
The InChIKey is OAYZCOJTVNTZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrN5O2S/c15-8-4-2-1-3-7(8)13-21-5-9(22-13)23-14-19-10-11(16)17-6-18-12(10)20-14/h1-6,13H,(H3,16,17,18,19,20).
What are the key properties of 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine?
8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine has a molecular weight of 392.24 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[[2-(2-bromophenyl)-1,3-dioxol-4-yl]sulfanyl]-7H-purin-6-amine is sourced from PubChem (CID 67188811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).