About 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide
2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide (PubChem CID 67188849) has the molecular formula C18H19BrN2O
and a molecular weight of 359.27 g/mol. Its IUPAC name is 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide.
Molecular Properties
| Compound Name | 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide |
| PubChem CID | 67188849 |
| Molecular Formula | C18H19BrN2O |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide |
| SMILES | CC(CO)N1CC[n+]2c1c1ccccc1c1ccccc12.[Br-] |
| InChI | InChI=1S/C18H19N2O.BrH/c1-13(12-21)19-10-11-20-17-9-5-4-7-15(17)14-6-2-3-8-16(14)18(19)20;/h2-9,13,21H,10-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | ITRJRZUKUNZEMO-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide?
The IUPAC name of 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide (CID 67188849) is 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide.
What is the SMILES notation for 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide?
The canonical SMILES for 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide is CC(CO)N1CC[n+]2c1c1ccccc1c1ccccc12.[Br-].
What is the InChIKey of 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide?
The InChIKey is ITRJRZUKUNZEMO-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H19N2O.BrH/c1-13(12-21)19-10-11-20-17-9-5-4-7-15(17)14-6-2-3-8-16(14)18(19)20;/h2-9,13,21H,10-12H2,1H3;1H/q+1;/p-1.
What are the key properties of 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide?
2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide has a molecular weight of 359.27 g/mol, XLogP of -0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium-1-yl)propan-1-ol bromide is sourced from PubChem (CID 67188849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).