About [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate
[1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate (PubChem CID 67188873) has the molecular formula C15H18BrNO4S
and a molecular weight of 388.28 g/mol. Its IUPAC name is [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate.
Molecular Properties
| Compound Name | [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate |
| PubChem CID | 67188873 |
| Molecular Formula | C15H18BrNO4S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate |
| SMILES | CC(C)(C)C(OC(N)=O)S(=O)(=O)c1ccc(C#CCBr)cc1 |
| InChI | InChI=1S/C15H18BrNO4S/c1-15(2,3)13(21-14(17)18)22(19,20)12-8-6-11(7-9-12)5-4-10-16/h6-9,13H,10H2,1-3H3,(H2,17,18) |
| InChIKey | CUWXAASODLBCKM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate?
The IUPAC name of [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate (CID 67188873) is [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate.
What is the SMILES notation for [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate?
The canonical SMILES for [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate is CC(C)(C)C(OC(N)=O)S(=O)(=O)c1ccc(C#CCBr)cc1.
What is the InChIKey of [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate?
The InChIKey is CUWXAASODLBCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrNO4S/c1-15(2,3)13(21-14(17)18)22(19,20)12-8-6-11(7-9-12)5-4-10-16/h6-9,13H,10H2,1-3H3,(H2,17,18).
What are the key properties of [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate?
[1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate has a molecular weight of 388.28 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(3-bromoprop-1-ynyl)phenyl]sulfonyl-2,2-dimethylpropyl] carbamate is sourced from PubChem (CID 67188873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).