C10H18N2O3 — CID 67189417
2,2,3a,6-tetramethyl-5,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide (PubChem CID 67189417) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,2,3a,6-tetramethyl-5,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide.
| Compound Name | 2,2,3a,6-tetramethyl-5,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 67189417 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2,2,3a,6-tetramethyl-5,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
| SMILES | CC1(C)OC2C(C)(CNC2(C)C(N)=O)O1 |
| InChI | InChI=1S/C10H18N2O3/c1-8(2)14-6-9(3,15-8)5-12-10(6,4)7(11)13/h6,12H,5H2,1-4H3,(H2,11,13) |
| InChIKey | HWQXUDIJHLXJJI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |