C28H44ClN3O4SSi — CID 67189816
(2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[1-(2-methyl-2-triethylsilyloxypropyl)pyrazol-3-yl]propanamide (PubChem CID 67189816) has the molecular formula C28H44ClN3O4SSi and a molecular weight of 582.28 g/mol. Its IUPAC name is (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[1-(2-methyl-2-triethylsilyloxypropyl)pyrazol-3-yl]propanamide.
| Compound Name | (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[1-(2-methyl-2-triethylsilyloxypropyl)pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 67189816 |
| Molecular Formula | C28H44ClN3O4SSi |
| Molecular Weight | 582.28 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[1-(2-methyl-2-triethylsilyloxypropyl)pyrazol-3-yl]propanamide |
| SMILES | CC[Si](CC)(CC)OC(C)(C)Cn1ccc(NC(=O)[C@H](CC2CCCC2)c2ccc(S(C)(=O)=O)c(Cl)c2)n1 |
| InChI | InChI=1S/C28H44ClN3O4SSi/c1-7-38(8-2,9-3)36-28(4,5)20-32-17-16-26(31-32)30-27(33)23(18-21-12-10-11-13-21)22-14-15-25(24(29)19-22)37(6,34)35/h14-17,19,21,23H,7-13,18,20H2,1-6H3,(H,30,31,33)/t23-/m1/s1 |
| InChIKey | LUGNAUCQNQTTJM-HSZRJFAPSA-N |
| XLogP | 7.04 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.28 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|