About 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine (PubChem CID 67190024) has the molecular formula C10H16N4O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine.
Molecular Properties
| Compound Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine |
| PubChem CID | 67190024 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine |
| SMILES | COc1nc(OC)nc(N2CCOC(C)C2)n1 |
| InChI | InChI=1S/C10H16N4O3/c1-7-6-14(4-5-17-7)8-11-9(15-2)13-10(12-8)16-3/h7H,4-6H2,1-3H3 |
| InChIKey | WMRMNNPIWCPOHF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine?
The IUPAC name of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine (CID 67190024) is 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine.
What is the SMILES notation for 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine?
The canonical SMILES for 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine is COc1nc(OC)nc(N2CCOC(C)C2)n1.
What is the InChIKey of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine?
The InChIKey is WMRMNNPIWCPOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3/c1-7-6-14(4-5-17-7)8-11-9(15-2)13-10(12-8)16-3/h7H,4-6H2,1-3H3.
What are the key properties of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine?
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine has a molecular weight of 240.26 g/mol, XLogP of 0.11, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-methylmorpholine is sourced from PubChem (CID 67190024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).