C17H32O6 — CID 67190127
7-(1,3-dioxan-2-yl)-5-[2-(1,3-dioxan-2-yl)ethyl]heptane-1,5-diol (PubChem CID 67190127) has the molecular formula C17H32O6 and a molecular weight of 332.44 g/mol. Its IUPAC name is 7-(1,3-dioxan-2-yl)-5-[2-(1,3-dioxan-2-yl)ethyl]heptane-1,5-diol.
| Compound Name | 7-(1,3-dioxan-2-yl)-5-[2-(1,3-dioxan-2-yl)ethyl]heptane-1,5-diol |
|---|---|
| PubChem CID | 67190127 |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 7-(1,3-dioxan-2-yl)-5-[2-(1,3-dioxan-2-yl)ethyl]heptane-1,5-diol |
| SMILES | OCCCCC(O)(CCC1OCCCO1)CCC1OCCCO1 |
| InChI | InChI=1S/C17H32O6/c18-10-2-1-7-17(19,8-5-15-20-11-3-12-21-15)9-6-16-22-13-4-14-23-16/h15-16,18-19H,1-14H2 |
| InChIKey | HNHTYZFKWGXZEG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|