C16H23F3N4O3S — CID 67190597
N-[(1S,2S)-2-aminocyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 67190597) has the molecular formula C16H23F3N4O3S and a molecular weight of 408.45 g/mol. Its IUPAC name is N-[(1S,2S)-2-aminocyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(1S,2S)-2-aminocyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67190597 |
| Molecular Formula | C16H23F3N4O3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[(1S,2S)-2-aminocyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCc2nc(C(=O)N[C@H]3CCCC[C@@H]3N)sc2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4OS.C2HF3O2/c1-18-7-6-11-12(8-18)20-14(17-11)13(19)16-10-5-3-2-4-9(10)15;3-2(4,5)1(6)7/h9-10H,2-8,15H2,1H3,(H,16,19);(H,6,7)/t9-,10-;/m0./s1 |
| InChIKey | YQVUWDIZCZZVPF-IYPAPVHQSA-N |
| XLogP | 1.76 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |