About 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine
6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine (PubChem CID 67191529) has the molecular formula C6H6N2
and a molecular weight of 106.13 g/mol. Its IUPAC name is 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine.
Molecular Properties
| Compound Name | 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine |
| PubChem CID | 67191529 |
| Molecular Formula | C6H6N2 |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine |
| SMILES | NC1c2cccc1n2 |
| InChI | InChI=1S/C6H6N2/c7-6-4-2-1-3-5(6)8-4/h1-3,6H,7H2 |
| InChIKey | WOYYLXMNIZOQHZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine?
The IUPAC name of 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine (CID 67191529) is 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine.
What is the SMILES notation for 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine?
The canonical SMILES for 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine is NC1c2cccc1n2.
What is the InChIKey of 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine?
The InChIKey is WOYYLXMNIZOQHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2/c7-6-4-2-1-3-5(6)8-4/h1-3,6H,7H2.
What are the key properties of 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine?
6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine has a molecular weight of 106.13 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azabicyclo[3.1.1]hepta-1(6),2,4-trien-7-amine is sourced from PubChem (CID 67191529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).