C28H42F5N3O3 — CID 67191681
N-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]-3-[1-hydroxy-5-methoxy-1-(2,3,5-trifluorophenyl)pentyl]piperidine-1-carboxamide (PubChem CID 67191681) has the molecular formula C28H42F5N3O3 and a molecular weight of 563.65 g/mol. Its IUPAC name is N-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]-3-[1-hydroxy-5-methoxy-1-(2,3,5-trifluorophenyl)pentyl]piperidine-1-carboxamide.
| Compound Name | N-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]-3-[1-hydroxy-5-methoxy-1-(2,3,5-trifluorophenyl)pentyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67191681 |
| Molecular Formula | C28H42F5N3O3 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | N-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]-3-[1-hydroxy-5-methoxy-1-(2,3,5-trifluorophenyl)pentyl]piperidine-1-carboxamide |
| SMILES | CNCC(CC1CCC(F)(F)CC1)NC(=O)N1CCCC(C(O)(CCCCOC)c2cc(F)cc(F)c2F)C1 |
| InChI | InChI=1S/C28H42F5N3O3/c1-34-17-22(14-19-7-10-27(32,33)11-8-19)35-26(37)36-12-5-6-20(18-36)28(38,9-3-4-13-39-2)23-15-21(29)16-24(30)25(23)31/h15-16,19-20,22,34,38H,3-14,17-18H2,1-2H3,(H,35,37) |
| InChIKey | QPJOUKZASXCZBA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|