About tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate
tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 67191724) has the molecular formula C14H25F2NO3
and a molecular weight of 293.35 g/mol. Its IUPAC name is tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate |
| PubChem CID | 67191724 |
| Molecular Formula | C14H25F2NO3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H25F2NO3/c1-13(2,3)20-12(19)17-11(9-18)8-10-4-6-14(15,16)7-5-10/h10-11,18H,4-9H2,1-3H3,(H,17,19) |
| InChIKey | CJTUCAWVORDAPO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate (CID 67191724) is tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate is CC(C)(C)OC(=O)NC(CO)CC1CCC(F)(F)CC1.
What is the InChIKey of tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate?
The InChIKey is CJTUCAWVORDAPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NO3/c1-13(2,3)20-12(19)17-11(9-18)8-10-4-6-14(15,16)7-5-10/h10-11,18H,4-9H2,1-3H3,(H,17,19).
What are the key properties of tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate?
tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate has a molecular weight of 293.35 g/mol, XLogP of 3.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-hydroxypropan-2-yl]carbamate is sourced from PubChem (CID 67191724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).