About 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid
1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid (PubChem CID 67191727) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 67191727 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)CC(CC1(C(=O)O)CCCC1)C(O)CO |
| InChI | InChI=1S/C12H20O6/c13-7-9(14)8(5-10(15)16)6-12(11(17)18)3-1-2-4-12/h8-9,13-14H,1-7H2,(H,15,16)(H,17,18) |
| InChIKey | HYTUOSKQZGVKCV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid?
The IUPAC name of 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid (CID 67191727) is 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid is O=C(O)CC(CC1(C(=O)O)CCCC1)C(O)CO.
What is the InChIKey of 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid?
The InChIKey is HYTUOSKQZGVKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c13-7-9(14)8(5-10(15)16)6-12(11(17)18)3-1-2-4-12/h8-9,13-14H,1-7H2,(H,15,16)(H,17,18).
What are the key properties of 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid?
1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid has a molecular weight of 260.29 g/mol, XLogP of 0.47, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(carboxymethyl)-3,4-dihydroxybutyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 67191727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).