About [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid
[(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid (PubChem CID 67192037) has the molecular formula C12H21F3N2O2
and a molecular weight of 282.31 g/mol. Its IUPAC name is [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid |
| PubChem CID | 67192037 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@H](CNCC(F)(F)F)CC1CCCCC1 |
| InChI | InChI=1S/C12H21F3N2O2/c13-12(14,15)8-16-7-10(17-11(18)19)6-9-4-2-1-3-5-9/h9-10,16-17H,1-8H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | AIHSNUPWTMZTGH-JTQLQIEISA-N |
| XLogP | 2.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid?
The IUPAC name of [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid (CID 67192037) is [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid.
What is the SMILES notation for [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid?
The canonical SMILES for [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid is O=C(O)N[C@H](CNCC(F)(F)F)CC1CCCCC1.
What is the InChIKey of [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid?
The InChIKey is AIHSNUPWTMZTGH-JTQLQIEISA-N. The full InChI is InChI=1S/C12H21F3N2O2/c13-12(14,15)8-16-7-10(17-11(18)19)6-9-4-2-1-3-5-9/h9-10,16-17H,1-8H2,(H,18,19)/t10-/m0/s1.
What are the key properties of [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid?
[(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid has a molecular weight of 282.31 g/mol, XLogP of 2.74, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-cyclohexyl-3-(2,2,2-trifluoroethylamino)propan-2-yl]carbamic acid is sourced from PubChem (CID 67192037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).