C31H46FN3O4 — CID 67192400
(3R)-3-[(1S)-1-[3-(4-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]-N-[4-methyl-1-(methylamino)pentan-2-yl]piperidine-1-carboxamide (PubChem CID 67192400) has the molecular formula C31H46FN3O4 and a molecular weight of 543.72 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-[3-(4-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]-N-[4-methyl-1-(methylamino)pentan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-1-[3-(4-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]-N-[4-methyl-1-(methylamino)pentan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67192400 |
| Molecular Formula | C31H46FN3O4 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | (3R)-3-[(1S)-1-[3-(4-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]-N-[4-methyl-1-(methylamino)pentan-2-yl]piperidine-1-carboxamide |
| SMILES | CNCC(CC(C)C)NC(=O)N1CCC[C@@H]([C@@](O)(CCCCOC)c2cccc(Oc3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C31H46FN3O4/c1-23(2)19-27(21-33-3)34-30(36)35-17-8-10-25(22-35)31(37,16-5-6-18-38-4)24-9-7-11-29(20-24)39-28-14-12-26(32)13-15-28/h7,9,11-15,20,23,25,27,33,37H,5-6,8,10,16-19,21-22H2,1-4H3,(H,34,36)/t25-,27?,31-/m1/s1 |
| InChIKey | RBYMPWQQLCSWJC-CKMKXUSASA-N |
| XLogP | 5.68 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|