C29H45F2N3O3 — CID 67192796
N-(4-cyclohexylpiperidin-3-yl)-3-[1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide (PubChem CID 67192796) has the molecular formula C29H45F2N3O3 and a molecular weight of 521.69 g/mol. Its IUPAC name is N-(4-cyclohexylpiperidin-3-yl)-3-[1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide.
| Compound Name | N-(4-cyclohexylpiperidin-3-yl)-3-[1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67192796 |
| Molecular Formula | C29H45F2N3O3 |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | N-(4-cyclohexylpiperidin-3-yl)-3-[1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide |
| SMILES | COCCCCC(O)(c1cccc(F)c1F)C1CCCN(C(=O)NC2CNCCC2C2CCCCC2)C1 |
| InChI | InChI=1S/C29H45F2N3O3/c1-37-18-6-5-15-29(36,24-12-7-13-25(30)27(24)31)22-11-8-17-34(20-22)28(35)33-26-19-32-16-14-23(26)21-9-3-2-4-10-21/h7,12-13,21-23,26,32,36H,2-6,8-11,14-20H2,1H3,(H,33,35) |
| InChIKey | LNPHNANLMXZICA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|