About benzo[h]quinazoline;2,3-dihydro-1H-imidazole
benzo[h]quinazoline;2,3-dihydro-1H-imidazole (PubChem CID 67192891) has the molecular formula C15H14N4
and a molecular weight of 250.31 g/mol. Its IUPAC name is benzo[h]quinazoline;2,3-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | benzo[h]quinazoline;2,3-dihydro-1H-imidazole |
| PubChem CID | 67192891 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | benzo[h]quinazoline;2,3-dihydro-1H-imidazole |
| SMILES | C1=CNCN1.c1ccc2c(c1)ccc1cncnc12 |
| InChI | InChI=1S/C12H8N2.C3H6N2/c1-2-4-11-9(3-1)5-6-10-7-13-8-14-12(10)11;1-2-5-3-4-1/h1-8H;1-2,4-5H,3H2 |
| InChIKey | JANNBLVATRUHMP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[h]quinazoline;2,3-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[h]quinazoline;2,3-dihydro-1H-imidazole?
The IUPAC name of benzo[h]quinazoline;2,3-dihydro-1H-imidazole (CID 67192891) is benzo[h]quinazoline;2,3-dihydro-1H-imidazole.
What is the SMILES notation for benzo[h]quinazoline;2,3-dihydro-1H-imidazole?
The canonical SMILES for benzo[h]quinazoline;2,3-dihydro-1H-imidazole is C1=CNCN1.c1ccc2c(c1)ccc1cncnc12.
What is the InChIKey of benzo[h]quinazoline;2,3-dihydro-1H-imidazole?
The InChIKey is JANNBLVATRUHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C3H6N2/c1-2-4-11-9(3-1)5-6-10-7-13-8-14-12(10)11;1-2-5-3-4-1/h1-8H;1-2,4-5H,3H2.
What are the key properties of benzo[h]quinazoline;2,3-dihydro-1H-imidazole?
benzo[h]quinazoline;2,3-dihydro-1H-imidazole has a molecular weight of 250.31 g/mol, XLogP of 2.39, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[h]quinazoline;2,3-dihydro-1H-imidazole is sourced from PubChem (CID 67192891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).