About [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol
[(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol (PubChem CID 67193160) has the molecular formula C8H13F2NO2
and a molecular weight of 193.19 g/mol. Its IUPAC name is [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol |
| PubChem CID | 67193160 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1C1COC1(F)F |
| InChI | InChI=1S/C8H13F2NO2/c9-8(10)7(5-13-8)11-3-1-2-6(11)4-12/h6-7,12H,1-5H2/t6-,7?/m0/s1 |
| InChIKey | KQNWNEDHOKGIKL-PKPIPKONSA-N |
| XLogP | 0.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol?
The IUPAC name of [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol (CID 67193160) is [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol is OC[C@@H]1CCCN1C1COC1(F)F.
What is the InChIKey of [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol?
The InChIKey is KQNWNEDHOKGIKL-PKPIPKONSA-N. The full InChI is InChI=1S/C8H13F2NO2/c9-8(10)7(5-13-8)11-3-1-2-6(11)4-12/h6-7,12H,1-5H2/t6-,7?/m0/s1.
What are the key properties of [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol?
[(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol has a molecular weight of 193.19 g/mol, XLogP of 0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(2,2-difluorooxetan-3-yl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 67193160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).