About 4,5-bis(prop-1-enyl)-1,3-dioxolane
4,5-bis(prop-1-enyl)-1,3-dioxolane (PubChem CID 67193200) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 4,5-bis(prop-1-enyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 4,5-bis(prop-1-enyl)-1,3-dioxolane |
| PubChem CID | 67193200 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 4,5-bis(prop-1-enyl)-1,3-dioxolane |
| SMILES | CC=CC1OCOC1C=CC |
| InChI | InChI=1S/C9H14O2/c1-3-5-8-9(6-4-2)11-7-10-8/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | CSPZUPBPIIUFNQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(prop-1-enyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(prop-1-enyl)-1,3-dioxolane?
The IUPAC name of 4,5-bis(prop-1-enyl)-1,3-dioxolane (CID 67193200) is 4,5-bis(prop-1-enyl)-1,3-dioxolane.
What is the SMILES notation for 4,5-bis(prop-1-enyl)-1,3-dioxolane?
The canonical SMILES for 4,5-bis(prop-1-enyl)-1,3-dioxolane is CC=CC1OCOC1C=CC.
What is the InChIKey of 4,5-bis(prop-1-enyl)-1,3-dioxolane?
The InChIKey is CSPZUPBPIIUFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-3-5-8-9(6-4-2)11-7-10-8/h3-6,8-9H,7H2,1-2H3.
What are the key properties of 4,5-bis(prop-1-enyl)-1,3-dioxolane?
4,5-bis(prop-1-enyl)-1,3-dioxolane has a molecular weight of 154.21 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(prop-1-enyl)-1,3-dioxolane is sourced from PubChem (CID 67193200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).