C11H14BrNO — CID 67193636
cis-(1S,2R)-2-(4-bromophenoxy)cyclopentan-1-amine (PubChem CID 67193636) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is cis-(1S,2R)-2-(4-bromophenoxy)cyclopentan-1-amine.
| Compound Name | cis-(1S,2R)-2-(4-bromophenoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 67193636 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | cis-(1S,2R)-2-(4-bromophenoxy)cyclopentan-1-amine |
| SMILES | N[C@H]1CCC[C@H]1Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrNO/c12-8-4-6-9(7-5-8)14-11-3-1-2-10(11)13/h4-7,10-11H,1-3,13H2/t10-,11+/m0/s1 |
| InChIKey | YNHOCLDRNYFRON-WDEREUQCSA-N |
| XLogP | 2.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |