C11H13F3N2O3 — CID 67193753
(3S)-4-hydroxy-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]butanamide (PubChem CID 67193753) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is (3S)-4-hydroxy-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]butanamide.
| Compound Name | (3S)-4-hydroxy-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]butanamide |
|---|---|
| PubChem CID | 67193753 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (3S)-4-hydroxy-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]butanamide |
| SMILES | NC(=O)C[C@H](CO)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H13F3N2O3/c12-11(13,14)6-19-8-1-2-9(16-4-8)7(5-17)3-10(15)18/h1-2,4,7,17H,3,5-6H2,(H2,15,18)/t7-/m1/s1 |
| InChIKey | BCVMLLXCQBJVQP-SSDOTTSWSA-N |
| XLogP | 0.97 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |