About 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine
4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 67194458) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 67194458 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC(C)Oc1ccc(-c2ncc(-c3cccc4c3CCC4N)o2)cc1 |
| InChI | InChI=1S/C21H22N2O2/c1-13(2)24-15-8-6-14(7-9-15)21-23-12-20(25-21)18-5-3-4-17-16(18)10-11-19(17)22/h3-9,12-13,19H,10-11,22H2,1-2H3 |
| InChIKey | MAFXREITPVUEAX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine (CID 67194458) is 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine is CC(C)Oc1ccc(-c2ncc(-c3cccc4c3CCC4N)o2)cc1.
What is the InChIKey of 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine?
The InChIKey is MAFXREITPVUEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-13(2)24-15-8-6-14(7-9-15)21-23-12-20(25-21)18-5-3-4-17-16(18)10-11-19(17)22/h3-9,12-13,19H,10-11,22H2,1-2H3.
What are the key properties of 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine?
4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine has a molecular weight of 334.42 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-propan-2-yloxyphenyl)-1,3-oxazol-5-yl]-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 67194458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).