C11H14N2 — CID 67194798
3a,4,5,9,9a,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline (PubChem CID 67194798) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3a,4,5,9,9a,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline.
| Compound Name | 3a,4,5,9,9a,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 67194798 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3a,4,5,9,9a,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline |
| SMILES | C1=CCC2C(=C1)NCC1C=CNC12 |
| InChI | InChI=1S/C11H14N2/c1-2-4-10-9(3-1)11-8(7-13-10)5-6-12-11/h1-2,4-6,8-9,11-13H,3,7H2 |
| InChIKey | KLKQHVRZHCEPFW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |