About 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one
9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one (PubChem CID 67194830) has the molecular formula C13H20N4O
and a molecular weight of 248.33 g/mol. Its IUPAC name is 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one.
Molecular Properties
| Compound Name | 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one |
| PubChem CID | 67194830 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one |
| SMILES | CCCn1cnc2c(c1=O)NCN2C1CCCC1 |
| InChI | InChI=1S/C13H20N4O/c1-2-7-16-8-15-12-11(13(16)18)14-9-17(12)10-5-3-4-6-10/h8,10,14H,2-7,9H2,1H3 |
| InChIKey | VRQVPHXLAMVBJV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one?
The IUPAC name of 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one (CID 67194830) is 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one.
What is the SMILES notation for 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one?
The canonical SMILES for 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one is CCCn1cnc2c(c1=O)NCN2C1CCCC1.
What is the InChIKey of 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one?
The InChIKey is VRQVPHXLAMVBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O/c1-2-7-16-8-15-12-11(13(16)18)14-9-17(12)10-5-3-4-6-10/h8,10,14H,2-7,9H2,1H3.
What are the key properties of 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one?
9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one has a molecular weight of 248.33 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopentyl-1-propyl-7,8-dihydropurin-6-one is sourced from PubChem (CID 67194830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).